C16H18N2O3S — CID 124610385
(3S)-3-methyl-1-[1-(thiophen-2-ylmethyl)pyrrole-2-carbonyl]pyrrolidine-3-carboxylic acid (PubChem CID 124610385) has the molecular formula C16H18N2O3S and a molecular weight of 318.40 g/mol. Its IUPAC name is (3S)-3-methyl-1-[1-(thiophen-2-ylmethyl)pyrrole-2-carbonyl]pyrrolidine-3-carboxylic acid.
| Compound Name | (3S)-3-methyl-1-[1-(thiophen-2-ylmethyl)pyrrole-2-carbonyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 124610385 |
| Molecular Formula | C16H18N2O3S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | (3S)-3-methyl-1-[1-(thiophen-2-ylmethyl)pyrrole-2-carbonyl]pyrrolidine-3-carboxylic acid |
| SMILES | C[C@]1(C(=O)O)CCN(C(=O)c2cccn2Cc2cccs2)C1 |
| InChI | InChI=1S/C16H18N2O3S/c1-16(15(20)21)6-8-18(11-16)14(19)13-5-2-7-17(13)10-12-4-3-9-22-12/h2-5,7,9H,6,8,10-11H2,1H3,(H,20,21)/t16-/m0/s1 |
| InChIKey | URNOWYYETGTYBR-INIZCTEOSA-N |
| XLogP | 2.53 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |