C22H22N2O3S — CID 119168407
4-phenyl-1-[1-(thiophen-2-ylmethyl)pyrrole-2-carbonyl]piperidine-4-carboxylic acid (PubChem CID 119168407) has the molecular formula C22H22N2O3S and a molecular weight of 394.50 g/mol. Its IUPAC name is 4-phenyl-1-[1-(thiophen-2-ylmethyl)pyrrole-2-carbonyl]piperidine-4-carboxylic acid.
| Compound Name | 4-phenyl-1-[1-(thiophen-2-ylmethyl)pyrrole-2-carbonyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 119168407 |
| Molecular Formula | C22H22N2O3S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 4-phenyl-1-[1-(thiophen-2-ylmethyl)pyrrole-2-carbonyl]piperidine-4-carboxylic acid |
| SMILES | O=C(c1cccn1Cc1cccs1)N1CCC(C(=O)O)(c2ccccc2)CC1 |
| InChI | InChI=1S/C22H22N2O3S/c25-20(19-9-4-12-24(19)16-18-8-5-15-28-18)23-13-10-22(11-14-23,21(26)27)17-6-2-1-3-7-17/h1-9,12,15H,10-11,13-14,16H2,(H,26,27) |
| InChIKey | ORAUXSPNZPDKNF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |