C15H20ClN3OS — CID 119376847
(4-aminopiperidin-1-yl)-[1-(thiophen-2-ylmethyl)pyrrol-2-yl]methanone;hydrochloride (PubChem CID 119376847) has the molecular formula C15H20ClN3OS and a molecular weight of 325.87 g/mol. Its IUPAC name is (4-aminopiperidin-1-yl)-[1-(thiophen-2-ylmethyl)pyrrol-2-yl]methanone;hydrochloride.
| Compound Name | (4-aminopiperidin-1-yl)-[1-(thiophen-2-ylmethyl)pyrrol-2-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119376847 |
| Molecular Formula | C15H20ClN3OS |
| Molecular Weight | 325.87 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | (4-aminopiperidin-1-yl)-[1-(thiophen-2-ylmethyl)pyrrol-2-yl]methanone;hydrochloride |
| SMILES | Cl.NC1CCN(C(=O)c2cccn2Cc2cccs2)CC1 |
| InChI | InChI=1S/C15H19N3OS.ClH/c16-12-5-8-17(9-6-12)15(19)14-4-1-7-18(14)11-13-3-2-10-20-13;/h1-4,7,10,12H,5-6,8-9,11,16H2;1H |
| InChIKey | SWPUHEQBLXPHAV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.87 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |