C17H20N2O3S — CID 119178450
2-[1-[1-(thiophen-2-ylmethyl)pyrrole-2-carbonyl]piperidin-4-yl]acetic acid (PubChem CID 119178450) has the molecular formula C17H20N2O3S and a molecular weight of 332.42 g/mol. Its IUPAC name is 2-[1-[1-(thiophen-2-ylmethyl)pyrrole-2-carbonyl]piperidin-4-yl]acetic acid.
| Compound Name | 2-[1-[1-(thiophen-2-ylmethyl)pyrrole-2-carbonyl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 119178450 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 2-[1-[1-(thiophen-2-ylmethyl)pyrrole-2-carbonyl]piperidin-4-yl]acetic acid |
| SMILES | O=C(O)CC1CCN(C(=O)c2cccn2Cc2cccs2)CC1 |
| InChI | InChI=1S/C17H20N2O3S/c20-16(21)11-13-5-8-18(9-6-13)17(22)15-4-1-7-19(15)12-14-3-2-10-23-14/h1-4,7,10,13H,5-6,8-9,11-12H2,(H,20,21) |
| InChIKey | HTRYETIIHFUWPN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |