C18H23N5O — CID 56821404
1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl-(5-methyl-2-phenyltriazol-4-yl)methanone (PubChem CID 56821404) has the molecular formula C18H23N5O and a molecular weight of 325.42 g/mol. Its IUPAC name is 1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl-(5-methyl-2-phenyltriazol-4-yl)methanone.
| Compound Name | 1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl-(5-methyl-2-phenyltriazol-4-yl)methanone |
|---|---|
| PubChem CID | 56821404 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl-(5-methyl-2-phenyltriazol-4-yl)methanone |
| SMILES | Cc1nn(-c2ccccc2)nc1C(=O)N1CCN2CCCCC2C1 |
| InChI | InChI=1S/C18H23N5O/c1-14-17(20-23(19-14)15-7-3-2-4-8-15)18(24)22-12-11-21-10-6-5-9-16(21)13-22/h2-4,7-8,16H,5-6,9-13H2,1H3 |
| InChIKey | YIXQVWFNPPBGED-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |