C18H21N3OS — CID 95589953
[(9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(2-phenyl-1,3-thiazol-5-yl)methanone (PubChem CID 95589953) has the molecular formula C18H21N3OS and a molecular weight of 327.45 g/mol. Its IUPAC name is [(9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(2-phenyl-1,3-thiazol-5-yl)methanone.
| Compound Name | [(9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(2-phenyl-1,3-thiazol-5-yl)methanone |
|---|---|
| PubChem CID | 95589953 |
| Molecular Formula | C18H21N3OS |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | [(9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(2-phenyl-1,3-thiazol-5-yl)methanone |
| SMILES | O=C(c1cnc(-c2ccccc2)s1)N1CCN2CCCC[C@@H]2C1 |
| InChI | InChI=1S/C18H21N3OS/c22-18(21-11-10-20-9-5-4-8-15(20)13-21)16-12-19-17(23-16)14-6-2-1-3-7-14/h1-3,6-7,12,15H,4-5,8-11,13H2/t15-/m1/s1 |
| InChIKey | SCHDMAIBYDQOER-OAHLLOKOSA-N |
| XLogP | 3.12 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |