C21H23N3OS — CID 51355372
[2-(2-phenylethynyl)-1,3-thiazol-5-yl]-(3-pyrrolidin-1-ylpiperidin-1-yl)methanone (PubChem CID 51355372) has the molecular formula C21H23N3OS and a molecular weight of 365.50 g/mol. Its IUPAC name is [2-(2-phenylethynyl)-1,3-thiazol-5-yl]-(3-pyrrolidin-1-ylpiperidin-1-yl)methanone.
| Compound Name | [2-(2-phenylethynyl)-1,3-thiazol-5-yl]-(3-pyrrolidin-1-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 51355372 |
| Molecular Formula | C21H23N3OS |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | [2-(2-phenylethynyl)-1,3-thiazol-5-yl]-(3-pyrrolidin-1-ylpiperidin-1-yl)methanone |
| SMILES | O=C(c1cnc(C#Cc2ccccc2)s1)N1CCCC(N2CCCC2)C1 |
| InChI | InChI=1S/C21H23N3OS/c25-21(24-14-6-9-18(16-24)23-12-4-5-13-23)19-15-22-20(26-19)11-10-17-7-2-1-3-8-17/h1-3,7-8,15,18H,4-6,9,12-14,16H2 |
| InChIKey | DUDJDCQZYCVKTN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|