C19H23N3O2 — CID 95590099
[(9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(5-methyl-2-phenyl-1,3-oxazol-4-yl)methanone (PubChem CID 95590099) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is [(9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(5-methyl-2-phenyl-1,3-oxazol-4-yl)methanone.
| Compound Name | [(9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(5-methyl-2-phenyl-1,3-oxazol-4-yl)methanone |
|---|---|
| PubChem CID | 95590099 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | [(9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(5-methyl-2-phenyl-1,3-oxazol-4-yl)methanone |
| SMILES | Cc1oc(-c2ccccc2)nc1C(=O)N1CCN2CCCC[C@@H]2C1 |
| InChI | InChI=1S/C19H23N3O2/c1-14-17(20-18(24-14)15-7-3-2-4-8-15)19(23)22-12-11-21-10-6-5-9-16(21)13-22/h2-4,7-8,16H,5-6,9-13H2,1H3/t16-/m1/s1 |
| InChIKey | LLNGGPMAXLZQPP-MRXNPFEDSA-N |
| XLogP | 2.96 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |