C18H22N4O — CID 95590134
[(9aS)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(3-phenyl-1H-pyrazol-5-yl)methanone (PubChem CID 95590134) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is [(9aS)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(3-phenyl-1H-pyrazol-5-yl)methanone.
| Compound Name | [(9aS)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(3-phenyl-1H-pyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 95590134 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | [(9aS)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-(3-phenyl-1H-pyrazol-5-yl)methanone |
| SMILES | O=C(c1cc(-c2ccccc2)n[nH]1)N1CCN2CCCC[C@H]2C1 |
| InChI | InChI=1S/C18H22N4O/c23-18(22-11-10-21-9-5-4-8-15(21)13-22)17-12-16(19-20-17)14-6-2-1-3-7-14/h1-3,6-7,12,15H,4-5,8-11,13H2,(H,19,20)/t15-/m0/s1 |
| InChIKey | QFUWOXUNVBRTKX-HNNXBMFYSA-N |
| XLogP | 2.39 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |