C16H19N3O — CID 27258020
[(3R)-3-methylpiperidin-1-yl]-(3-phenyl-1H-pyrazol-5-yl)methanone (PubChem CID 27258020) has the molecular formula C16H19N3O and a molecular weight of 269.35 g/mol. Its IUPAC name is [(3R)-3-methylpiperidin-1-yl]-(3-phenyl-1H-pyrazol-5-yl)methanone.
| Compound Name | [(3R)-3-methylpiperidin-1-yl]-(3-phenyl-1H-pyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 27258020 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | [(3R)-3-methylpiperidin-1-yl]-(3-phenyl-1H-pyrazol-5-yl)methanone |
| SMILES | C[C@@H]1CCCN(C(=O)c2cc(-c3ccccc3)n[nH]2)C1 |
| InChI | InChI=1S/C16H19N3O/c1-12-6-5-9-19(11-12)16(20)15-10-14(17-18-15)13-7-3-2-4-8-13/h2-4,7-8,10,12H,5-6,9,11H2,1H3,(H,17,18)/t12-/m1/s1 |
| InChIKey | ASFXTVYOBLHRFO-GFCCVEGCSA-N |
| XLogP | 2.95 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |