C18H20N2O2S — CID 71970238
(4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl)-thiophen-2-ylmethanone (PubChem CID 71970238) has the molecular formula C18H20N2O2S and a molecular weight of 328.44 g/mol. Its IUPAC name is (4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl)-thiophen-2-ylmethanone.
| Compound Name | (4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl)-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 71970238 |
| Molecular Formula | C18H20N2O2S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | (4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl)-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)N1CC2OCCN(Cc3ccccc3)C2C1 |
| InChI | InChI=1S/C18H20N2O2S/c21-18(17-7-4-10-23-17)20-12-15-16(13-20)22-9-8-19(15)11-14-5-2-1-3-6-14/h1-7,10,15-16H,8-9,11-13H2 |
| InChIKey | DFQOHCUEZXUYBO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |