C16H21F3N2O5S — CID 127023077
[(4aR,7aS)-4-(2-methoxyethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-thiophen-2-ylmethanone;2,2,2-trifluoroacetic acid (PubChem CID 127023077) has the molecular formula C16H21F3N2O5S and a molecular weight of 410.41 g/mol. Its IUPAC name is [(4aR,7aS)-4-(2-methoxyethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-thiophen-2-ylmethanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(4aR,7aS)-4-(2-methoxyethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-thiophen-2-ylmethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127023077 |
| Molecular Formula | C16H21F3N2O5S |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | [(4aR,7aS)-4-(2-methoxyethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-thiophen-2-ylmethanone;2,2,2-trifluoroacetic acid |
| SMILES | COCCN1CCO[C@H]2CN(C(=O)c3cccs3)C[C@H]21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H20N2O3S.C2HF3O2/c1-18-6-4-15-5-7-19-12-10-16(9-11(12)15)14(17)13-3-2-8-20-13;3-2(4,5)1(6)7/h2-3,8,11-12H,4-7,9-10H2,1H3;(H,6,7)/t11-,12+;/m1./s1 |
| InChIKey | BVFFCTGXLAYFMY-LYCTWNKOSA-N |
| XLogP | 1.55 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |