C18H23F3N2O5S — CID 155857161
[(4aR,7aS)-4-(oxolan-2-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-thiophen-3-ylmethanone;2,2,2-trifluoroacetic acid (PubChem CID 155857161) has the molecular formula C18H23F3N2O5S and a molecular weight of 436.45 g/mol. Its IUPAC name is [(4aR,7aS)-4-(oxolan-2-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-thiophen-3-ylmethanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(4aR,7aS)-4-(oxolan-2-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-thiophen-3-ylmethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155857161 |
| Molecular Formula | C18H23F3N2O5S |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | [(4aR,7aS)-4-(oxolan-2-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-thiophen-3-ylmethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(c1ccsc1)N1C[C@@H]2OCCN(CC3CCCO3)[C@@H]2C1 |
| InChI | InChI=1S/C16H22N2O3S.C2HF3O2/c19-16(12-3-7-22-11-12)18-9-14-15(10-18)21-6-4-17(14)8-13-2-1-5-20-13;3-2(4,5)1(6)7/h3,7,11,13-15H,1-2,4-6,8-10H2;(H,6,7)/t13?,14-,15+;/m1./s1 |
| InChIKey | NKMLGDMDVCZQFK-OFYGOMGKSA-N |
| XLogP | 2.09 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |