C10H12FNO2S — CID 129348850
[(2R)-2-(fluoromethyl)morpholin-4-yl]-thiophen-3-ylmethanone (PubChem CID 129348850) has the molecular formula C10H12FNO2S and a molecular weight of 229.28 g/mol. Its IUPAC name is [(2R)-2-(fluoromethyl)morpholin-4-yl]-thiophen-3-ylmethanone.
| Compound Name | [(2R)-2-(fluoromethyl)morpholin-4-yl]-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 129348850 |
| Molecular Formula | C10H12FNO2S |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | [(2R)-2-(fluoromethyl)morpholin-4-yl]-thiophen-3-ylmethanone |
| SMILES | O=C(c1ccsc1)N1CCO[C@@H](CF)C1 |
| InChI | InChI=1S/C10H12FNO2S/c11-5-9-6-12(2-3-14-9)10(13)8-1-4-15-7-8/h1,4,7,9H,2-3,5-6H2/t9-/m0/s1 |
| InChIKey | GQEZQRBWZDQNQH-VIFPVBQESA-N |
| XLogP | 1.56 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |