C14H16N4O2S — CID 125008845
[(2S)-2-[3-(methylamino)pyrazin-2-yl]morpholin-4-yl]-thiophen-3-ylmethanone (PubChem CID 125008845) has the molecular formula C14H16N4O2S and a molecular weight of 304.38 g/mol. Its IUPAC name is [(2S)-2-[3-(methylamino)pyrazin-2-yl]morpholin-4-yl]-thiophen-3-ylmethanone.
| Compound Name | [(2S)-2-[3-(methylamino)pyrazin-2-yl]morpholin-4-yl]-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 125008845 |
| Molecular Formula | C14H16N4O2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | [(2S)-2-[3-(methylamino)pyrazin-2-yl]morpholin-4-yl]-thiophen-3-ylmethanone |
| SMILES | CNc1nccnc1[C@@H]1CN(C(=O)c2ccsc2)CCO1 |
| InChI | InChI=1S/C14H16N4O2S/c1-15-13-12(16-3-4-17-13)11-8-18(5-6-20-11)14(19)10-2-7-21-9-10/h2-4,7,9,11H,5-6,8H2,1H3,(H,15,17)/t11-/m0/s1 |
| InChIKey | UYBQJXBYABFMOU-NSHDSACASA-N |
| XLogP | 1.79 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |