C19H19N5O2 — CID 125018611
[(2S)-2-[3-(methylamino)pyrazin-2-yl]morpholin-4-yl]-quinolin-3-ylmethanone (PubChem CID 125018611) has the molecular formula C19H19N5O2 and a molecular weight of 349.39 g/mol. Its IUPAC name is [(2S)-2-[3-(methylamino)pyrazin-2-yl]morpholin-4-yl]-quinolin-3-ylmethanone.
| Compound Name | [(2S)-2-[3-(methylamino)pyrazin-2-yl]morpholin-4-yl]-quinolin-3-ylmethanone |
|---|---|
| PubChem CID | 125018611 |
| Molecular Formula | C19H19N5O2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | [(2S)-2-[3-(methylamino)pyrazin-2-yl]morpholin-4-yl]-quinolin-3-ylmethanone |
| SMILES | CNc1nccnc1[C@@H]1CN(C(=O)c2cnc3ccccc3c2)CCO1 |
| InChI | InChI=1S/C19H19N5O2/c1-20-18-17(21-6-7-22-18)16-12-24(8-9-26-16)19(25)14-10-13-4-2-3-5-15(13)23-11-14/h2-7,10-11,16H,8-9,12H2,1H3,(H,20,22)/t16-/m0/s1 |
| InChIKey | XQAPYCDFJKNYNL-INIZCTEOSA-N |
| XLogP | 2.28 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |