C16H24N4O3 — CID 131640062
[(4aR,7aS)-4-(oxolan-2-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(3-methylimidazol-4-yl)methanone (PubChem CID 131640062) has the molecular formula C16H24N4O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is [(4aR,7aS)-4-(oxolan-2-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(3-methylimidazol-4-yl)methanone.
| Compound Name | [(4aR,7aS)-4-(oxolan-2-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(3-methylimidazol-4-yl)methanone |
|---|---|
| PubChem CID | 131640062 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | [(4aR,7aS)-4-(oxolan-2-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(3-methylimidazol-4-yl)methanone |
| SMILES | Cn1cncc1C(=O)N1C[C@@H]2OCCN(CC3CCCO3)[C@@H]2C1 |
| InChI | InChI=1S/C16H24N4O3/c1-18-11-17-7-13(18)16(21)20-9-14-15(10-20)23-6-4-19(14)8-12-3-2-5-22-12/h7,11-12,14-15H,2-6,8-10H2,1H3/t12?,14-,15+/m1/s1 |
| InChIKey | BLGGKGCASKYRCR-UCWKZMIHSA-N |
| XLogP | 0.12 |
| TPSA | 59.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |