C20H31F3N2O5 — CID 155845262
1-[(4aR,7aS)-4-(oxolan-2-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-2-cyclopentylethanone;2,2,2-trifluoroacetic acid (PubChem CID 155845262) has the molecular formula C20H31F3N2O5 and a molecular weight of 436.47 g/mol. Its IUPAC name is 1-[(4aR,7aS)-4-(oxolan-2-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-2-cyclopentylethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[(4aR,7aS)-4-(oxolan-2-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-2-cyclopentylethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155845262 |
| Molecular Formula | C20H31F3N2O5 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 1-[(4aR,7aS)-4-(oxolan-2-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-2-cyclopentylethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(CC1CCCC1)N1C[C@@H]2OCCN(CC3CCCO3)[C@@H]2C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H30N2O3.C2HF3O2/c21-18(10-14-4-1-2-5-14)20-12-16-17(13-20)23-9-7-19(16)11-15-6-3-8-22-15;3-2(4,5)1(6)7/h14-17H,1-13H2;(H,6,7)/t15?,16-,17+;/m1./s1 |
| InChIKey | WMNUADZSGXIXTD-CUSAOGOYSA-N |
| XLogP | 2.29 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |