C15H26F3N3O5 — CID 171694381
1-[(4aR,7aS)-4-[2-(dimethylamino)ethyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-2-methoxyethanone;2,2,2-trifluoroacetic acid (PubChem CID 171694381) has the molecular formula C15H26F3N3O5 and a molecular weight of 385.38 g/mol. Its IUPAC name is 1-[(4aR,7aS)-4-[2-(dimethylamino)ethyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-2-methoxyethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[(4aR,7aS)-4-[2-(dimethylamino)ethyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-2-methoxyethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171694381 |
| Molecular Formula | C15H26F3N3O5 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 1-[(4aR,7aS)-4-[2-(dimethylamino)ethyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-2-methoxyethanone;2,2,2-trifluoroacetic acid |
| SMILES | COCC(=O)N1C[C@@H]2OCCN(CCN(C)C)[C@@H]2C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H25N3O3.C2HF3O2/c1-14(2)4-5-15-6-7-19-12-9-16(8-11(12)15)13(17)10-18-3;3-2(4,5)1(6)7/h11-12H,4-10H2,1-3H3;(H,6,7)/t11-,12+;/m1./s1 |
| InChIKey | WEBXOWSBLPWXKE-LYCTWNKOSA-N |
| XLogP | -0.26 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |