C21H33N3O8 — CID 155875346
(2,4-dimethoxyphenyl)-[4-[2-(dimethylamino)ethyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]methanone;formic acid (PubChem CID 155875346) has the molecular formula C21H33N3O8 and a molecular weight of 455.51 g/mol. Its IUPAC name is (2,4-dimethoxyphenyl)-[4-[2-(dimethylamino)ethyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]methanone;formic acid.
| Compound Name | (2,4-dimethoxyphenyl)-[4-[2-(dimethylamino)ethyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]methanone;formic acid |
|---|---|
| PubChem CID | 155875346 |
| Molecular Formula | C21H33N3O8 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | (2,4-dimethoxyphenyl)-[4-[2-(dimethylamino)ethyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]methanone;formic acid |
| SMILES | COc1ccc(C(=O)N2CC3OCCN(CCN(C)C)C3C2)c(OC)c1.O=CO.O=CO |
| InChI | InChI=1S/C19H29N3O4.2CH2O2/c1-20(2)7-8-21-9-10-26-18-13-22(12-16(18)21)19(23)15-6-5-14(24-3)11-17(15)25-4;2*2-1-3/h5-6,11,16,18H,7-10,12-13H2,1-4H3;2*1H,(H,2,3) |
| InChIKey | OBSBFFZNRYBTKZ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|