C17H26N2O6 — CID 71785900
(2,4-dimethoxyphenyl)-[3-[(dimethylamino)methyl]morpholin-4-yl]methanone;formic acid (PubChem CID 71785900) has the molecular formula C17H26N2O6 and a molecular weight of 354.40 g/mol. Its IUPAC name is (2,4-dimethoxyphenyl)-[3-[(dimethylamino)methyl]morpholin-4-yl]methanone;formic acid.
| Compound Name | (2,4-dimethoxyphenyl)-[3-[(dimethylamino)methyl]morpholin-4-yl]methanone;formic acid |
|---|---|
| PubChem CID | 71785900 |
| Molecular Formula | C17H26N2O6 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | (2,4-dimethoxyphenyl)-[3-[(dimethylamino)methyl]morpholin-4-yl]methanone;formic acid |
| SMILES | COc1ccc(C(=O)N2CCOCC2CN(C)C)c(OC)c1.O=CO |
| InChI | InChI=1S/C16H24N2O4.CH2O2/c1-17(2)10-12-11-22-8-7-18(12)16(19)14-6-5-13(20-3)9-15(14)21-4;2-1-3/h5-6,9,12H,7-8,10-11H2,1-4H3;1H,(H,2,3) |
| InChIKey | OPLKZWVXQLLZDG-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|