C13H21N3O5 — CID 71786025
[3-[(dimethylamino)methyl]morpholin-4-yl]-(5-methyl-1,2-oxazol-3-yl)methanone;formic acid (PubChem CID 71786025) has the molecular formula C13H21N3O5 and a molecular weight of 299.33 g/mol. Its IUPAC name is [3-[(dimethylamino)methyl]morpholin-4-yl]-(5-methyl-1,2-oxazol-3-yl)methanone;formic acid.
| Compound Name | [3-[(dimethylamino)methyl]morpholin-4-yl]-(5-methyl-1,2-oxazol-3-yl)methanone;formic acid |
|---|---|
| PubChem CID | 71786025 |
| Molecular Formula | C13H21N3O5 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | [3-[(dimethylamino)methyl]morpholin-4-yl]-(5-methyl-1,2-oxazol-3-yl)methanone;formic acid |
| SMILES | Cc1cc(C(=O)N2CCOCC2CN(C)C)no1.O=CO |
| InChI | InChI=1S/C12H19N3O3.CH2O2/c1-9-6-11(13-18-9)12(16)15-4-5-17-8-10(15)7-14(2)3;2-1-3/h6,10H,4-5,7-8H2,1-3H3;1H,(H,2,3) |
| InChIKey | CRPWGKNJCXXQHP-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|