C19H29N3O4 — CID 155875347
(2,4-dimethoxyphenyl)-[4-[2-(dimethylamino)ethyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]methanone (PubChem CID 155875347) has the molecular formula C19H29N3O4 and a molecular weight of 363.46 g/mol. Its IUPAC name is (2,4-dimethoxyphenyl)-[4-[2-(dimethylamino)ethyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]methanone.
| Compound Name | (2,4-dimethoxyphenyl)-[4-[2-(dimethylamino)ethyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]methanone |
|---|---|
| PubChem CID | 155875347 |
| Molecular Formula | C19H29N3O4 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | (2,4-dimethoxyphenyl)-[4-[2-(dimethylamino)ethyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]methanone |
| SMILES | COc1ccc(C(=O)N2CC3OCCN(CCN(C)C)C3C2)c(OC)c1 |
| InChI | InChI=1S/C19H29N3O4/c1-20(2)7-8-21-9-10-26-18-13-22(12-16(18)21)19(23)15-6-5-14(24-3)11-17(15)25-4/h5-6,11,16,18H,7-10,12-13H2,1-4H3 |
| InChIKey | PCHUNAIAYREKDA-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 54.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |