C16H25F6N3O6 — CID 155830291
1-[(5aS,8aS)-4-methyl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-2-(dimethylamino)ethanone;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155830291) has the molecular formula C16H25F6N3O6 and a molecular weight of 469.38 g/mol. Its IUPAC name is 1-[(5aS,8aS)-4-methyl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-2-(dimethylamino)ethanone;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 1-[(5aS,8aS)-4-methyl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-2-(dimethylamino)ethanone;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155830291 |
| Molecular Formula | C16H25F6N3O6 |
| Molecular Weight | 469.38 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | 1-[(5aS,8aS)-4-methyl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-2-(dimethylamino)ethanone;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN(C)CC(=O)N1C[C@@H]2CN(C)CCO[C@@H]2C1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H23N3O2.2C2HF3O2/c1-13(2)9-12(16)15-7-10-6-14(3)4-5-17-11(10)8-15;2*3-2(4,5)1(6)7/h10-11H,4-9H2,1-3H3;2*(H,6,7)/t10-,11+;;/m0../s1 |
| InChIKey | HXHWHEJOSNWXDK-IREPQIBFSA-N |
| XLogP | 0.60 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.38 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |