C13H20N4O2 — CID 129345073
[(4aR,8aR)-6-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-4-yl]-(3-methylimidazol-4-yl)methanone (PubChem CID 129345073) has the molecular formula C13H20N4O2 and a molecular weight of 264.33 g/mol. Its IUPAC name is [(4aR,8aR)-6-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-4-yl]-(3-methylimidazol-4-yl)methanone.
| Compound Name | [(4aR,8aR)-6-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-4-yl]-(3-methylimidazol-4-yl)methanone |
|---|---|
| PubChem CID | 129345073 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | [(4aR,8aR)-6-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-4-yl]-(3-methylimidazol-4-yl)methanone |
| SMILES | CN1CC[C@H]2OCCN(C(=O)c3cncn3C)[C@@H]2C1 |
| InChI | InChI=1S/C13H20N4O2/c1-15-4-3-12-11(8-15)17(5-6-19-12)13(18)10-7-14-9-16(10)2/h7,9,11-12H,3-6,8H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | MNACDGAACUJASO-VXGBXAGGSA-N |
| XLogP | -0.03 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |