C15H24N4O2 — CID 129485457
[(4aR,8aS)-6-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-4-yl]-(1,3,5-trimethylpyrazol-4-yl)methanone (PubChem CID 129485457) has the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is [(4aR,8aS)-6-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-4-yl]-(1,3,5-trimethylpyrazol-4-yl)methanone.
| Compound Name | [(4aR,8aS)-6-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-4-yl]-(1,3,5-trimethylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 129485457 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | [(4aR,8aS)-6-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-4-yl]-(1,3,5-trimethylpyrazol-4-yl)methanone |
| SMILES | Cc1nn(C)c(C)c1C(=O)N1CCO[C@H]2CCN(C)C[C@H]21 |
| InChI | InChI=1S/C15H24N4O2/c1-10-14(11(2)18(4)16-10)15(20)19-7-8-21-13-5-6-17(3)9-12(13)19/h12-13H,5-9H2,1-4H3/t12-,13+/m1/s1 |
| InChIKey | WMCRMYMOJDBMJM-OLZOCXBDSA-N |
| XLogP | 0.58 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |