C13H20N4O — CID 43594784
[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-(1,3,5-trimethylpyrazol-4-yl)methanone (PubChem CID 43594784) has the molecular formula C13H20N4O and a molecular weight of 248.33 g/mol. Its IUPAC name is [(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-(1,3,5-trimethylpyrazol-4-yl)methanone.
| Compound Name | [(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-(1,3,5-trimethylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 43594784 |
| Molecular Formula | C13H20N4O |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | [(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-(1,3,5-trimethylpyrazol-4-yl)methanone |
| SMILES | Cc1nn(C)c(C)c1C(=O)N1CC[C@H]2CNC[C@H]21 |
| InChI | InChI=1S/C13H20N4O/c1-8-12(9(2)16(3)15-8)13(18)17-5-4-10-6-14-7-11(10)17/h10-11,14H,4-7H2,1-3H3/t10-,11+/m0/s1 |
| InChIKey | IRIFPULZJMYRJP-WDEREUQCSA-N |
| XLogP | 0.47 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |