C11H16N4O — CID 103120579
[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-(1-methylpyrazol-3-yl)methanone (PubChem CID 103120579) has the molecular formula C11H16N4O and a molecular weight of 220.28 g/mol. Its IUPAC name is [(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-(1-methylpyrazol-3-yl)methanone.
| Compound Name | [(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-(1-methylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 103120579 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | [(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-(1-methylpyrazol-3-yl)methanone |
| SMILES | Cn1ccc(C(=O)N2CC[C@H]3CNC[C@H]32)n1 |
| InChI | InChI=1S/C11H16N4O/c1-14-4-3-9(13-14)11(16)15-5-2-8-6-12-7-10(8)15/h3-4,8,10,12H,2,5-7H2,1H3/t8-,10+/m0/s1 |
| InChIKey | QNJLMAONQYTJEJ-WCBMZHEXSA-N |
| XLogP | -0.15 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |