C10H14N4O — CID 63080847
[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-(1H-pyrazol-5-yl)methanone (PubChem CID 63080847) has the molecular formula C10H14N4O and a molecular weight of 206.25 g/mol. Its IUPAC name is [(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-(1H-pyrazol-5-yl)methanone.
| Compound Name | [(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-(1H-pyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 63080847 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | [(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-(1H-pyrazol-5-yl)methanone |
| SMILES | O=C(c1ccn[nH]1)N1CC[C@H]2CNC[C@H]21 |
| InChI | InChI=1S/C10H14N4O/c15-10(8-1-3-12-13-8)14-4-2-7-5-11-6-9(7)14/h1,3,7,9,11H,2,4-6H2,(H,12,13)/t7-,9+/m0/s1 |
| InChIKey | VVVOIFYECAUAJN-IONNQARKSA-N |
| XLogP | -0.16 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |