C16H16F2N4O — CID 128876674
[(3aR,6aR)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-[1-(2,4-difluorophenyl)pyrazol-3-yl]methanone (PubChem CID 128876674) has the molecular formula C16H16F2N4O and a molecular weight of 318.33 g/mol. Its IUPAC name is [(3aR,6aR)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-[1-(2,4-difluorophenyl)pyrazol-3-yl]methanone.
| Compound Name | [(3aR,6aR)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-[1-(2,4-difluorophenyl)pyrazol-3-yl]methanone |
|---|---|
| PubChem CID | 128876674 |
| Molecular Formula | C16H16F2N4O |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | [(3aR,6aR)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-[1-(2,4-difluorophenyl)pyrazol-3-yl]methanone |
| SMILES | O=C(c1ccn(-c2ccc(F)cc2F)n1)N1CC[C@@H]2CNC[C@@H]21 |
| InChI | InChI=1S/C16H16F2N4O/c17-11-1-2-14(12(18)7-11)22-6-4-13(20-22)16(23)21-5-3-10-8-19-9-15(10)21/h1-2,4,6-7,10,15,19H,3,5,8-9H2/t10-,15+/m1/s1 |
| InChIKey | JKWDSKOBCQBLOP-BMIGLBTASA-N |
| XLogP | 1.58 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |