C19H25Cl2N3O — CID 154899877
[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-(2,3,6-trimethylquinolin-4-yl)methanone;dihydrochloride (PubChem CID 154899877) has the molecular formula C19H25Cl2N3O and a molecular weight of 382.34 g/mol. Its IUPAC name is [(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-(2,3,6-trimethylquinolin-4-yl)methanone;dihydrochloride.
| Compound Name | [(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-(2,3,6-trimethylquinolin-4-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 154899877 |
| Molecular Formula | C19H25Cl2N3O |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | [(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-(2,3,6-trimethylquinolin-4-yl)methanone;dihydrochloride |
| SMILES | Cc1ccc2nc(C)c(C)c(C(=O)N3CC[C@H]4CNC[C@H]43)c2c1.Cl.Cl |
| InChI | InChI=1S/C19H23N3O.2ClH/c1-11-4-5-16-15(8-11)18(12(2)13(3)21-16)19(23)22-7-6-14-9-20-10-17(14)22;;/h4-5,8,14,17,20H,6-7,9-10H2,1-3H3;2*1H/t14-,17+;;/m0../s1 |
| InChIKey | IKIUGJUVEHYYDT-LKCMVLIGSA-N |
| XLogP | 3.44 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |