C19H23N3O — CID 133120312
[(3aR,6aR)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-(2,6,8-trimethylquinolin-4-yl)methanone (PubChem CID 133120312) has the molecular formula C19H23N3O and a molecular weight of 309.41 g/mol. Its IUPAC name is [(3aR,6aR)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-(2,6,8-trimethylquinolin-4-yl)methanone.
| Compound Name | [(3aR,6aR)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-(2,6,8-trimethylquinolin-4-yl)methanone |
|---|---|
| PubChem CID | 133120312 |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | [(3aR,6aR)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-(2,6,8-trimethylquinolin-4-yl)methanone |
| SMILES | Cc1cc(C)c2nc(C)cc(C(=O)N3CC[C@@H]4CNC[C@@H]43)c2c1 |
| InChI | InChI=1S/C19H23N3O/c1-11-6-12(2)18-15(7-11)16(8-13(3)21-18)19(23)22-5-4-14-9-20-10-17(14)22/h6-8,14,17,20H,4-5,9-10H2,1-3H3/t14-,17+/m1/s1 |
| InChIKey | AVHALKCGOSAZLK-PBHICJAKSA-N |
| XLogP | 2.59 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |