C21H27Cl2N3O — CID 120656910
[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(2-cyclopropyl-6,8-dimethylquinolin-4-yl)methanone;dihydrochloride (PubChem CID 120656910) has the molecular formula C21H27Cl2N3O and a molecular weight of 408.37 g/mol. Its IUPAC name is [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(2-cyclopropyl-6,8-dimethylquinolin-4-yl)methanone;dihydrochloride.
| Compound Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(2-cyclopropyl-6,8-dimethylquinolin-4-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 120656910 |
| Molecular Formula | C21H27Cl2N3O |
| Molecular Weight | 408.37 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(2-cyclopropyl-6,8-dimethylquinolin-4-yl)methanone;dihydrochloride |
| SMILES | Cc1cc(C)c2nc(C3CC3)cc(C(=O)N3C[C@H]4CNC[C@H]4C3)c2c1.Cl.Cl |
| InChI | InChI=1S/C21H25N3O.2ClH/c1-12-5-13(2)20-17(6-12)18(7-19(23-20)14-3-4-14)21(25)24-10-15-8-22-9-16(15)11-24;;/h5-7,14-16,22H,3-4,8-11H2,1-2H3;2*1H/t15-,16+;; |
| InChIKey | BITPEJIDOQWSJU-TYIJTUDGSA-N |
| XLogP | 3.86 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.37 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |