C20H22N2O — CID 133126161
[(3aR,6aR)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-[2-(2-methylphenyl)phenyl]methanone (PubChem CID 133126161) has the molecular formula C20H22N2O and a molecular weight of 306.41 g/mol. Its IUPAC name is [(3aR,6aR)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-[2-(2-methylphenyl)phenyl]methanone.
| Compound Name | [(3aR,6aR)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-[2-(2-methylphenyl)phenyl]methanone |
|---|---|
| PubChem CID | 133126161 |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | [(3aR,6aR)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-[2-(2-methylphenyl)phenyl]methanone |
| SMILES | Cc1ccccc1-c1ccccc1C(=O)N1CC[C@@H]2CNC[C@@H]21 |
| InChI | InChI=1S/C20H22N2O/c1-14-6-2-3-7-16(14)17-8-4-5-9-18(17)20(23)22-11-10-15-12-21-13-19(15)22/h2-9,15,19,21H,10-13H2,1H3/t15-,19+/m1/s1 |
| InChIKey | CQCNBSLBBSZRLD-BEFAXECRSA-N |
| XLogP | 3.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |