C15H20N2O — CID 43594813
[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-(3,4-dimethylphenyl)methanone (PubChem CID 43594813) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is [(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-(3,4-dimethylphenyl)methanone.
| Compound Name | [(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-(3,4-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 43594813 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | [(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-(3,4-dimethylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)N2CC[C@H]3CNC[C@H]32)cc1C |
| InChI | InChI=1S/C15H20N2O/c1-10-3-4-12(7-11(10)2)15(18)17-6-5-13-8-16-9-14(13)17/h3-4,7,13-14,16H,5-6,8-9H2,1-2H3/t13-,14+/m0/s1 |
| InChIKey | XOLTZSCNIRJBEC-UONOGXRCSA-N |
| XLogP | 1.74 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |