C25H27ClN2O — CID 172912803
[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-[6-(2,3-dimethylphenyl)naphthalen-2-yl]methanone;hydrochloride (PubChem CID 172912803) has the molecular formula C25H27ClN2O and a molecular weight of 406.96 g/mol. Its IUPAC name is [(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-[6-(2,3-dimethylphenyl)naphthalen-2-yl]methanone;hydrochloride.
| Compound Name | [(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-[6-(2,3-dimethylphenyl)naphthalen-2-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 172912803 |
| Molecular Formula | C25H27ClN2O |
| Molecular Weight | 406.96 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | [(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-[6-(2,3-dimethylphenyl)naphthalen-2-yl]methanone;hydrochloride |
| SMILES | Cc1cccc(-c2ccc3cc(C(=O)N4CC[C@H]5CNC[C@H]54)ccc3c2)c1C.Cl |
| InChI | InChI=1S/C25H26N2O.ClH/c1-16-4-3-5-23(17(16)2)20-8-6-19-13-21(9-7-18(19)12-20)25(28)27-11-10-22-14-26-15-24(22)27;/h3-9,12-13,22,24,26H,10-11,14-15H2,1-2H3;1H/t22-,24+;/m0./s1 |
| InChIKey | AMVLKJDTVOASPJ-ROOQTRKKSA-N |
| XLogP | 4.98 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.96 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |