C23H25Cl2N3O — CID 154903602
[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-[3-(2-methylquinolin-4-yl)phenyl]methanone;dihydrochloride (PubChem CID 154903602) has the molecular formula C23H25Cl2N3O and a molecular weight of 430.38 g/mol. Its IUPAC name is [(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-[3-(2-methylquinolin-4-yl)phenyl]methanone;dihydrochloride.
| Compound Name | [(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-[3-(2-methylquinolin-4-yl)phenyl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 154903602 |
| Molecular Formula | C23H25Cl2N3O |
| Molecular Weight | 430.38 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | [(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-[3-(2-methylquinolin-4-yl)phenyl]methanone;dihydrochloride |
| SMILES | Cc1cc(-c2cccc(C(=O)N3CC[C@H]4CNC[C@H]43)c2)c2ccccc2n1.Cl.Cl |
| InChI | InChI=1S/C23H23N3O.2ClH/c1-15-11-20(19-7-2-3-8-21(19)25-15)16-5-4-6-17(12-16)23(27)26-10-9-18-13-24-14-22(18)26;;/h2-8,11-12,18,22,24H,9-10,13-14H2,1H3;2*1H/t18-,22+;;/m0../s1 |
| InChIKey | XJWFZABRDGGLCE-ATVRCVQASA-N |
| XLogP | 4.49 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.38 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |