C20H21ClF2N2O2 — CID 154905573
[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-[4-[4-(difluoromethoxy)phenyl]phenyl]methanone;hydrochloride (PubChem CID 154905573) has the molecular formula C20H21ClF2N2O2 and a molecular weight of 394.85 g/mol. Its IUPAC name is [(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-[4-[4-(difluoromethoxy)phenyl]phenyl]methanone;hydrochloride.
| Compound Name | [(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-[4-[4-(difluoromethoxy)phenyl]phenyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 154905573 |
| Molecular Formula | C20H21ClF2N2O2 |
| Molecular Weight | 394.85 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | [(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-[4-[4-(difluoromethoxy)phenyl]phenyl]methanone;hydrochloride |
| SMILES | Cl.O=C(c1ccc(-c2ccc(OC(F)F)cc2)cc1)N1CC[C@H]2CNC[C@H]21 |
| InChI | InChI=1S/C20H20F2N2O2.ClH/c21-20(22)26-17-7-5-14(6-8-17)13-1-3-15(4-2-13)19(25)24-10-9-16-11-23-12-18(16)24;/h1-8,16,18,20,23H,9-12H2;1H/t16-,18+;/m0./s1 |
| InChIKey | ATQKKWHBVKQYAR-KUGOCAJQSA-N |
| XLogP | 3.81 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.85 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |