2,3,6-trimethylquinoline-4-carbonyl chloride

C13H12ClNO — CID 146553345

IUPAC2,3,6-trimethylquinoline-4-carbonyl chloride
SMILESCc1ccc2nc(C)c(C)c(C(=O)Cl)c2c1
InChIInChI=1S/C13H12ClNO/c1-7-4-5-11-10(6-7)12(13(14)16)8(2)9(3)15-11/h4-6H,1-3H3
InChIKeyPBKMEWFUJIPMKL-UHFFFAOYSA-N
MW233.70 g/mol
LogP3.54
Rot. Bonds1

About 2,3,6-trimethylquinoline-4-carbonyl chloride

2,3,6-trimethylquinoline-4-carbonyl chloride (PubChem CID 146553345) has the molecular formula C13H12ClNO and a molecular weight of 233.70 g/mol. Its IUPAC name is 2,3,6-trimethylquinoline-4-carbonyl chloride.

Molecular Properties

Compound Name2,3,6-trimethylquinoline-4-carbonyl chloride
PubChem CID146553345
Molecular FormulaC13H12ClNO
Molecular Weight233.70 g/mol
Exact Mass233.06
IUPAC Name2,3,6-trimethylquinoline-4-carbonyl chloride
SMILESCc1ccc2nc(C)c(C)c(C(=O)Cl)c2c1
InChIInChI=1S/C13H12ClNO/c1-7-4-5-11-10(6-7)12(13(14)16)8(2)9(3)15-11/h4-6H,1-3H3
InChIKeyPBKMEWFUJIPMKL-UHFFFAOYSA-N
XLogP3.54
TPSA29.96 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.70
LogP ≤ 53.54
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2,3,6-trimethylquinoline-4-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3,6-trimethylquinoline-4-carbonyl chloride?
The IUPAC name of 2,3,6-trimethylquinoline-4-carbonyl chloride (CID 146553345) is 2,3,6-trimethylquinoline-4-carbonyl chloride.
What is the SMILES notation for 2,3,6-trimethylquinoline-4-carbonyl chloride?
The canonical SMILES for 2,3,6-trimethylquinoline-4-carbonyl chloride is Cc1ccc2nc(C)c(C)c(C(=O)Cl)c2c1.
What is the InChIKey of 2,3,6-trimethylquinoline-4-carbonyl chloride?
The InChIKey is PBKMEWFUJIPMKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12ClNO/c1-7-4-5-11-10(6-7)12(13(14)16)8(2)9(3)15-11/h4-6H,1-3H3.
What are the key properties of 2,3,6-trimethylquinoline-4-carbonyl chloride?
2,3,6-trimethylquinoline-4-carbonyl chloride has a molecular weight of 233.70 g/mol, XLogP of 3.54, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,6-trimethylquinoline-4-carbonyl chloride is sourced from PubChem (CID 146553345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).