C11H9Cl2N — CID 54483448
3,4-dichloro-2,6-dimethylquinoline (PubChem CID 54483448) has the molecular formula C11H9Cl2N and a molecular weight of 226.11 g/mol. Its IUPAC name is 3,4-dichloro-2,6-dimethylquinoline.
| Compound Name | 3,4-dichloro-2,6-dimethylquinoline |
|---|---|
| PubChem CID | 54483448 |
| Molecular Formula | C11H9Cl2N |
| Molecular Weight | 226.11 g/mol |
| Exact Mass | 225.01 |
| IUPAC Name | 3,4-dichloro-2,6-dimethylquinoline |
| SMILES | Cc1ccc2nc(C)c(Cl)c(Cl)c2c1 |
| InChI | InChI=1S/C11H9Cl2N/c1-6-3-4-9-8(5-6)11(13)10(12)7(2)14-9/h3-5H,1-2H3 |
| InChIKey | XQQKEKRKAONBKM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.11 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |