C13H14NS- — CID 7362104
3-ethyl-2,6-dimethylquinoline-4-thiolate (PubChem CID 7362104) has the molecular formula C13H14NS- and a molecular weight of 216.33 g/mol. Its IUPAC name is 3-ethyl-2,6-dimethylquinoline-4-thiolate.
| Compound Name | 3-ethyl-2,6-dimethylquinoline-4-thiolate |
|---|---|
| PubChem CID | 7362104 |
| Molecular Formula | C13H14NS- |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 3-ethyl-2,6-dimethylquinoline-4-thiolate |
| SMILES | CCc1c(C)nc2ccc(C)cc2c1[S-] |
| InChI | InChI=1S/C13H15NS/c1-4-10-9(3)14-12-6-5-8(2)7-11(12)13(10)15/h5-7H,4H2,1-3H3,(H,14,15)/p-1 |
| InChIKey | FJANDRQVMCBMTL-UHFFFAOYSA-M |
| XLogP | 3.32 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|