C14H16BrN — CID 125452623
6-bromo-3,4-diethyl-2-methylquinoline (PubChem CID 125452623) has the molecular formula C14H16BrN and a molecular weight of 278.19 g/mol. Its IUPAC name is 6-bromo-3,4-diethyl-2-methylquinoline.
| Compound Name | 6-bromo-3,4-diethyl-2-methylquinoline |
|---|---|
| PubChem CID | 125452623 |
| Molecular Formula | C14H16BrN |
| Molecular Weight | 278.19 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 6-bromo-3,4-diethyl-2-methylquinoline |
| SMILES | CCc1c(C)nc2ccc(Br)cc2c1CC |
| InChI | InChI=1S/C14H16BrN/c1-4-11-9(3)16-14-7-6-10(15)8-13(14)12(11)5-2/h6-8H,4-5H2,1-3H3 |
| InChIKey | NSUFKOQLLMFBBE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.19 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |