C13H9BrF3NO2 — CID 160910807
6-bromo-3-ethyl-2-(trifluoromethyl)quinoline-4-carboxylic acid (PubChem CID 160910807) has the molecular formula C13H9BrF3NO2 and a molecular weight of 348.12 g/mol. Its IUPAC name is 6-bromo-3-ethyl-2-(trifluoromethyl)quinoline-4-carboxylic acid.
| Compound Name | 6-bromo-3-ethyl-2-(trifluoromethyl)quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 160910807 |
| Molecular Formula | C13H9BrF3NO2 |
| Molecular Weight | 348.12 g/mol |
| Exact Mass | 346.98 |
| IUPAC Name | 6-bromo-3-ethyl-2-(trifluoromethyl)quinoline-4-carboxylic acid |
| SMILES | CCc1c(C(F)(F)F)nc2ccc(Br)cc2c1C(=O)O |
| InChI | InChI=1S/C13H9BrF3NO2/c1-2-7-10(12(19)20)8-5-6(14)3-4-9(8)18-11(7)13(15,16)17/h3-5H,2H2,1H3,(H,19,20) |
| InChIKey | SQTDRSJLUSJCAY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.12 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |