C19H13BrF3NO2 — CID 152718657
6-bromo-3-methyl-2-[3-methyl-2-(trifluoromethyl)phenyl]quinoline-4-carboxylic acid (PubChem CID 152718657) has the molecular formula C19H13BrF3NO2 and a molecular weight of 424.22 g/mol. Its IUPAC name is 6-bromo-3-methyl-2-[3-methyl-2-(trifluoromethyl)phenyl]quinoline-4-carboxylic acid.
| Compound Name | 6-bromo-3-methyl-2-[3-methyl-2-(trifluoromethyl)phenyl]quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 152718657 |
| Molecular Formula | C19H13BrF3NO2 |
| Molecular Weight | 424.22 g/mol |
| Exact Mass | 423.01 |
| IUPAC Name | 6-bromo-3-methyl-2-[3-methyl-2-(trifluoromethyl)phenyl]quinoline-4-carboxylic acid |
| SMILES | Cc1cccc(-c2nc3ccc(Br)cc3c(C(=O)O)c2C)c1C(F)(F)F |
| InChI | InChI=1S/C19H13BrF3NO2/c1-9-4-3-5-12(16(9)19(21,22)23)17-10(2)15(18(25)26)13-8-11(20)6-7-14(13)24-17/h3-8H,1-2H3,(H,25,26) |
| InChIKey | ZVDNXSYUHHJFCR-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.22 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |