C25H19BrN2O3 — CID 118947974
4-[(6-bromo-3-methyl-2-phenylquinoline-4-carbonyl)amino]-3-methylbenzoic acid (PubChem CID 118947974) has the molecular formula C25H19BrN2O3 and a molecular weight of 475.34 g/mol. Its IUPAC name is 4-[(6-bromo-3-methyl-2-phenylquinoline-4-carbonyl)amino]-3-methylbenzoic acid.
| Compound Name | 4-[(6-bromo-3-methyl-2-phenylquinoline-4-carbonyl)amino]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 118947974 |
| Molecular Formula | C25H19BrN2O3 |
| Molecular Weight | 475.34 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | 4-[(6-bromo-3-methyl-2-phenylquinoline-4-carbonyl)amino]-3-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1NC(=O)c1c(C)c(-c2ccccc2)nc2ccc(Br)cc12 |
| InChI | InChI=1S/C25H19BrN2O3/c1-14-12-17(25(30)31)8-10-20(14)28-24(29)22-15(2)23(16-6-4-3-5-7-16)27-21-11-9-18(26)13-19(21)22/h3-13H,1-2H3,(H,28,29)(H,30,31) |
| InChIKey | TUHZDEPWTLSPBE-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.34 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |