C28H23BrN4O3 — CID 176682537
4-[(6-bromo-3-methyl-2-phenylquinoline-4-carbonyl)amino]-3-[(1Z,3Z)-1,4-diaminobuta-1,3-dienyl]benzoic acid (PubChem CID 176682537) has the molecular formula C28H23BrN4O3 and a molecular weight of 543.42 g/mol. Its IUPAC name is 4-[(6-bromo-3-methyl-2-phenylquinoline-4-carbonyl)amino]-3-[(1Z,3Z)-1,4-diaminobuta-1,3-dienyl]benzoic acid.
| Compound Name | 4-[(6-bromo-3-methyl-2-phenylquinoline-4-carbonyl)amino]-3-[(1Z,3Z)-1,4-diaminobuta-1,3-dienyl]benzoic acid |
|---|---|
| PubChem CID | 176682537 |
| Molecular Formula | C28H23BrN4O3 |
| Molecular Weight | 543.42 g/mol |
| Exact Mass | 542.10 |
| IUPAC Name | 4-[(6-bromo-3-methyl-2-phenylquinoline-4-carbonyl)amino]-3-[(1Z,3Z)-1,4-diaminobuta-1,3-dienyl]benzoic acid |
| SMILES | Cc1c(-c2ccccc2)nc2ccc(Br)cc2c1C(=O)Nc1ccc(C(=O)O)cc1/C(N)=C/C=C\N |
| InChI | InChI=1S/C28H23BrN4O3/c1-16-25(21-15-19(29)10-12-24(21)32-26(16)17-6-3-2-4-7-17)27(34)33-23-11-9-18(28(35)36)14-20(23)22(31)8-5-13-30/h2-15H,30-31H2,1H3,(H,33,34)(H,35,36)/b13-5-,22-8- |
| InChIKey | FPTPCJSYBMCFMM-GNHMXMERSA-N |
| XLogP | 5.70 |
| TPSA | 131.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.42 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|