C30H28BrFN6O4 — CID 137371071
[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl] 4-[(6-bromo-3-methyl-2-phenylquinoline-4-carbonyl)amino]-3-fluorobenzoate (PubChem CID 137371071) has the molecular formula C30H28BrFN6O4 and a molecular weight of 635.49 g/mol. Its IUPAC name is [(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl] 4-[(6-bromo-3-methyl-2-phenylquinoline-4-carbonyl)amino]-3-fluorobenzoate.
| Compound Name | [(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl] 4-[(6-bromo-3-methyl-2-phenylquinoline-4-carbonyl)amino]-3-fluorobenzoate |
|---|---|
| PubChem CID | 137371071 |
| Molecular Formula | C30H28BrFN6O4 |
| Molecular Weight | 635.49 g/mol |
| Exact Mass | 634.13 |
| IUPAC Name | [(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl] 4-[(6-bromo-3-methyl-2-phenylquinoline-4-carbonyl)amino]-3-fluorobenzoate |
| SMILES | Cc1c(-c2ccccc2)nc2ccc(Br)cc2c1C(=O)Nc1ccc(C(=O)OC(=O)[C@@H](N)CCCN=C(N)N)cc1F |
| InChI | InChI=1S/C30H28BrFN6O4/c1-16-25(20-15-19(31)10-12-23(20)37-26(16)17-6-3-2-4-7-17)27(39)38-24-11-9-18(14-21(24)32)28(40)42-29(41)22(33)8-5-13-36-30(34)35/h2-4,6-7,9-12,14-15,22H,5,8,13,33H2,1H3,(H,38,39)(H4,34,35,36)/t22-/m0/s1 |
| InChIKey | JEXWTSZWJSJGLV-QFIPXVFZSA-N |
| XLogP | 4.43 |
| TPSA | 175.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.49 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|