C28H24BrClN2O3 — CID 175016679
[2-[(6-bromo-3-methyl-2-phenylquinoline-4-carbonyl)amino]-5-chlorophenyl] pentanoate (PubChem CID 175016679) has the molecular formula C28H24BrClN2O3 and a molecular weight of 551.87 g/mol. Its IUPAC name is [2-[(6-bromo-3-methyl-2-phenylquinoline-4-carbonyl)amino]-5-chlorophenyl] pentanoate.
| Compound Name | [2-[(6-bromo-3-methyl-2-phenylquinoline-4-carbonyl)amino]-5-chlorophenyl] pentanoate |
|---|---|
| PubChem CID | 175016679 |
| Molecular Formula | C28H24BrClN2O3 |
| Molecular Weight | 551.87 g/mol |
| Exact Mass | 550.07 |
| IUPAC Name | [2-[(6-bromo-3-methyl-2-phenylquinoline-4-carbonyl)amino]-5-chlorophenyl] pentanoate |
| SMILES | CCCCC(=O)Oc1cc(Cl)ccc1NC(=O)c1c(C)c(-c2ccccc2)nc2ccc(Br)cc12 |
| InChI | InChI=1S/C28H24BrClN2O3/c1-3-4-10-25(33)35-24-16-20(30)12-14-23(24)32-28(34)26-17(2)27(18-8-6-5-7-9-18)31-22-13-11-19(29)15-21(22)26/h5-9,11-16H,3-4,10H2,1-2H3,(H,32,34) |
| InChIKey | HYIBGVYBMZTNHP-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.87 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|