C23H17ClN2O3S — CID 2221006
methyl 3-[(6-chloro-3-methyl-2-phenylquinoline-4-carbonyl)amino]thiophene-2-carboxylate (PubChem CID 2221006) has the molecular formula C23H17ClN2O3S and a molecular weight of 436.92 g/mol. Its IUPAC name is methyl 3-[(6-chloro-3-methyl-2-phenylquinoline-4-carbonyl)amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[(6-chloro-3-methyl-2-phenylquinoline-4-carbonyl)amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 2221006 |
| Molecular Formula | C23H17ClN2O3S |
| Molecular Weight | 436.92 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | methyl 3-[(6-chloro-3-methyl-2-phenylquinoline-4-carbonyl)amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)c1c(C)c(-c2ccccc2)nc2ccc(Cl)cc12 |
| InChI | InChI=1S/C23H17ClN2O3S/c1-13-19(22(27)26-18-10-11-30-21(18)23(28)29-2)16-12-15(24)8-9-17(16)25-20(13)14-6-4-3-5-7-14/h3-12H,1-2H3,(H,26,27) |
| InChIKey | DCZSQWVLVKNDRW-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.92 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |