C25H17F3N2O3 — CID 118948447
4-[[6-(difluoromethyl)-3-methyl-2-phenylquinoline-4-carbonyl]amino]-3-fluorobenzoic acid (PubChem CID 118948447) has the molecular formula C25H17F3N2O3 and a molecular weight of 450.42 g/mol. Its IUPAC name is 4-[[6-(difluoromethyl)-3-methyl-2-phenylquinoline-4-carbonyl]amino]-3-fluorobenzoic acid.
| Compound Name | 4-[[6-(difluoromethyl)-3-methyl-2-phenylquinoline-4-carbonyl]amino]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 118948447 |
| Molecular Formula | C25H17F3N2O3 |
| Molecular Weight | 450.42 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 4-[[6-(difluoromethyl)-3-methyl-2-phenylquinoline-4-carbonyl]amino]-3-fluorobenzoic acid |
| SMILES | Cc1c(-c2ccccc2)nc2ccc(C(F)F)cc2c1C(=O)Nc1ccc(C(=O)O)cc1F |
| InChI | InChI=1S/C25H17F3N2O3/c1-13-21(24(31)30-20-10-8-16(25(32)33)12-18(20)26)17-11-15(23(27)28)7-9-19(17)29-22(13)14-5-3-2-4-6-14/h2-12,23H,1H3,(H,30,31)(H,32,33) |
| InChIKey | PVPPBSWMPLOPHQ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.42 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |